C17H16FN3O2 — CID 99958111
1-N'-[(R)-(4-fluorophenyl)-pyridin-4-ylmethyl]cyclopropane-1,1-dicarboxamide (PubChem CID 99958111) has the molecular formula C17H16FN3O2 and a molecular weight of 313.33 g/mol. Its IUPAC name is 1-N'-[(R)-(4-fluorophenyl)-pyridin-4-ylmethyl]cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N'-[(R)-(4-fluorophenyl)-pyridin-4-ylmethyl]cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 99958111 |
| Molecular Formula | C17H16FN3O2 |
| Molecular Weight | 313.33 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | 1-N'-[(R)-(4-fluorophenyl)-pyridin-4-ylmethyl]cyclopropane-1,1-dicarboxamide |
| SMILES | NC(=O)C1(C(=O)N[C@@H](c2ccncc2)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C17H16FN3O2/c18-13-3-1-11(2-4-13)14(12-5-9-20-10-6-12)21-16(23)17(7-8-17)15(19)22/h1-6,9-10,14H,7-8H2,(H2,19,22)(H,21,23)/t14-/m1/s1 |
| InChIKey | MNWOEISCYPYEFE-CQSZACIVSA-N |
| XLogP | 1.69 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.33 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|