C14H15N5O2S — CID 91791956
1-N'-[(5-amino-1,3,4-thiadiazol-2-yl)-phenylmethyl]cyclopropane-1,1-dicarboxamide (PubChem CID 91791956) has the molecular formula C14H15N5O2S and a molecular weight of 317.37 g/mol. Its IUPAC name is 1-N'-[(5-amino-1,3,4-thiadiazol-2-yl)-phenylmethyl]cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N'-[(5-amino-1,3,4-thiadiazol-2-yl)-phenylmethyl]cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 91791956 |
| Molecular Formula | C14H15N5O2S |
| Molecular Weight | 317.37 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | 1-N'-[(5-amino-1,3,4-thiadiazol-2-yl)-phenylmethyl]cyclopropane-1,1-dicarboxamide |
| SMILES | NC(=O)C1(C(=O)NC(c2ccccc2)c2nnc(N)s2)CC1 |
| InChI | InChI=1S/C14H15N5O2S/c15-11(20)14(6-7-14)12(21)17-9(8-4-2-1-3-5-8)10-18-19-13(16)22-10/h1-5,9H,6-7H2,(H2,15,20)(H2,16,19)(H,17,21) |
| InChIKey | CVYHZGUUECXNGU-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 123.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.37 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|