C28H38F2N2O3 — CID 23388433
tert-butyl N-[1-[4,4-bis(4-fluorophenyl)butylamino]-4-methyl-1-oxopentan-2-yl]-N-methylcarbamate (PubChem CID 23388433) has the molecular formula C28H38F2N2O3 and a molecular weight of 488.62 g/mol. Its IUPAC name is tert-butyl N-[1-[4,4-bis(4-fluorophenyl)butylamino]-4-methyl-1-oxopentan-2-yl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[1-[4,4-bis(4-fluorophenyl)butylamino]-4-methyl-1-oxopentan-2-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 23388433 |
| Molecular Formula | C28H38F2N2O3 |
| Molecular Weight | 488.62 g/mol |
| Exact Mass | 488.29 |
| IUPAC Name | tert-butyl N-[1-[4,4-bis(4-fluorophenyl)butylamino]-4-methyl-1-oxopentan-2-yl]-N-methylcarbamate |
| SMILES | CC(C)CC(C(=O)NCCCC(c1ccc(F)cc1)c1ccc(F)cc1)N(C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C28H38F2N2O3/c1-19(2)18-25(32(6)27(34)35-28(3,4)5)26(33)31-17-7-8-24(20-9-13-22(29)14-10-20)21-11-15-23(30)16-12-21/h9-16,19,24-25H,7-8,17-18H2,1-6H3,(H,31,33) |
| InChIKey | OLDYLQFCFVIBQK-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.62 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|