C14H20FNO3 — CID 116860960
tert-butyl N-[1-(4-fluorophenyl)-2-hydroxyethyl]-N-methylcarbamate (PubChem CID 116860960) has the molecular formula C14H20FNO3 and a molecular weight of 269.32 g/mol. Its IUPAC name is tert-butyl N-[1-(4-fluorophenyl)-2-hydroxyethyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[1-(4-fluorophenyl)-2-hydroxyethyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 116860960 |
| Molecular Formula | C14H20FNO3 |
| Molecular Weight | 269.32 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | tert-butyl N-[1-(4-fluorophenyl)-2-hydroxyethyl]-N-methylcarbamate |
| SMILES | CN(C(=O)OC(C)(C)C)C(CO)c1ccc(F)cc1 |
| InChI | InChI=1S/C14H20FNO3/c1-14(2,3)19-13(18)16(4)12(9-17)10-5-7-11(15)8-6-10/h5-8,12,17H,9H2,1-4H3 |
| InChIKey | KHUGEYGETRMRAA-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.32 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |