C14H21FN2O2 — CID 82023502
tert-butyl N-[2-amino-1-(4-fluorophenyl)ethyl]-N-methylcarbamate (PubChem CID 82023502) has the molecular formula C14H21FN2O2 and a molecular weight of 268.33 g/mol. Its IUPAC name is tert-butyl N-[2-amino-1-(4-fluorophenyl)ethyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[2-amino-1-(4-fluorophenyl)ethyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 82023502 |
| Molecular Formula | C14H21FN2O2 |
| Molecular Weight | 268.33 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | tert-butyl N-[2-amino-1-(4-fluorophenyl)ethyl]-N-methylcarbamate |
| SMILES | CN(C(=O)OC(C)(C)C)C(CN)c1ccc(F)cc1 |
| InChI | InChI=1S/C14H21FN2O2/c1-14(2,3)19-13(18)17(4)12(9-16)10-5-7-11(15)8-6-10/h5-8,12H,9,16H2,1-4H3 |
| InChIKey | YDTPVTDYQFFYRD-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.33 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |