About N-[4,4-bis(4-fluorophenyl)butyl]-2-(cyclohexylmethylamino)-3-methylbutanamide
N-[4,4-bis(4-fluorophenyl)butyl]-2-(cyclohexylmethylamino)-3-methylbutanamide (PubChem CID 18418760) has the molecular formula C28H38F2N2O
and a molecular weight of 456.62 g/mol. Its IUPAC name is N-[4,4-bis(4-fluorophenyl)butyl]-2-(cyclohexylmethylamino)-3-methylbutanamide.
Molecular Properties
| Compound Name | N-[4,4-bis(4-fluorophenyl)butyl]-2-(cyclohexylmethylamino)-3-methylbutanamide |
| PubChem CID | 18418760 |
| Molecular Formula | C28H38F2N2O |
| Molecular Weight | 456.62 g/mol |
| Exact Mass | 456.30 |
| IUPAC Name | N-[4,4-bis(4-fluorophenyl)butyl]-2-(cyclohexylmethylamino)-3-methylbutanamide |
| SMILES | CC(C)C(NCC1CCCCC1)C(=O)NCCCC(c1ccc(F)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C28H38F2N2O/c1-20(2)27(32-19-21-7-4-3-5-8-21)28(33)31-18-6-9-26(22-10-14-24(29)15-11-22)23-12-16-25(30)17-13-23/h10-17,20-21,26-27,32H,3-9,18-19H2,1-2H3,(H,31,33) |
| InChIKey | JKNFNFBDRCYUIU-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 456.62 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[4,4-bis(4-fluorophenyl)butyl]-2-(cyclohexylmethylamino)-3-methylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4,4-bis(4-fluorophenyl)butyl]-2-(cyclohexylmethylamino)-3-methylbutanamide?
The IUPAC name of N-[4,4-bis(4-fluorophenyl)butyl]-2-(cyclohexylmethylamino)-3-methylbutanamide (CID 18418760) is N-[4,4-bis(4-fluorophenyl)butyl]-2-(cyclohexylmethylamino)-3-methylbutanamide.
What is the SMILES notation for N-[4,4-bis(4-fluorophenyl)butyl]-2-(cyclohexylmethylamino)-3-methylbutanamide?
The canonical SMILES for N-[4,4-bis(4-fluorophenyl)butyl]-2-(cyclohexylmethylamino)-3-methylbutanamide is CC(C)C(NCC1CCCCC1)C(=O)NCCCC(c1ccc(F)cc1)c1ccc(F)cc1.
What is the InChIKey of N-[4,4-bis(4-fluorophenyl)butyl]-2-(cyclohexylmethylamino)-3-methylbutanamide?
The InChIKey is JKNFNFBDRCYUIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H38F2N2O/c1-20(2)27(32-19-21-7-4-3-5-8-21)28(33)31-18-6-9-26(22-10-14-24(29)15-11-22)23-12-16-25(30)17-13-23/h10-17,20-21,26-27,32H,3-9,18-19H2,1-2H3,(H,31,33).
What are the key properties of N-[4,4-bis(4-fluorophenyl)butyl]-2-(cyclohexylmethylamino)-3-methylbutanamide?
N-[4,4-bis(4-fluorophenyl)butyl]-2-(cyclohexylmethylamino)-3-methylbutanamide has a molecular weight of 456.62 g/mol, XLogP of 6.19, 11 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4,4-bis(4-fluorophenyl)butyl]-2-(cyclohexylmethylamino)-3-methylbutanamide is sourced from PubChem (CID 18418760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).