C28H38F2N2O — CID 18418760
N-[4,4-bis(4-fluorophenyl)butyl]-2-(cyclohexylmethylamino)-3-methylbutanamide (PubChem CID 18418760) has the molecular formula C28H38F2N2O and a molecular weight of 456.62 g/mol. Its IUPAC name is N-[4,4-bis(4-fluorophenyl)butyl]-2-(cyclohexylmethylamino)-3-methylbutanamide.
| Compound Name | N-[4,4-bis(4-fluorophenyl)butyl]-2-(cyclohexylmethylamino)-3-methylbutanamide |
|---|---|
| PubChem CID | 18418760 |
| Molecular Formula | C28H38F2N2O |
| Molecular Weight | 456.62 g/mol |
| Exact Mass | 456.30 |
| IUPAC Name | N-[4,4-bis(4-fluorophenyl)butyl]-2-(cyclohexylmethylamino)-3-methylbutanamide |
| SMILES | CC(C)C(NCC1CCCCC1)C(=O)NCCCC(c1ccc(F)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C28H38F2N2O/c1-20(2)27(32-19-21-7-4-3-5-8-21)28(33)31-18-6-9-26(22-10-14-24(29)15-11-22)23-12-16-25(30)17-13-23/h10-17,20-21,26-27,32H,3-9,18-19H2,1-2H3,(H,31,33) |
| InChIKey | JKNFNFBDRCYUIU-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.62 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|