C20H30FN3O3S — CID 66590328
(2S)-N-[(3aR,4S,6aS)-2-(4-fluorophenyl)sulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]-2-(methylamino)hexanamide (PubChem CID 66590328) has the molecular formula C20H30FN3O3S and a molecular weight of 411.54 g/mol. Its IUPAC name is (2S)-N-[(3aR,4S,6aS)-2-(4-fluorophenyl)sulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]-2-(methylamino)hexanamide.
| Compound Name | (2S)-N-[(3aR,4S,6aS)-2-(4-fluorophenyl)sulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]-2-(methylamino)hexanamide |
|---|---|
| PubChem CID | 66590328 |
| Molecular Formula | C20H30FN3O3S |
| Molecular Weight | 411.54 g/mol |
| Exact Mass | 411.20 |
| IUPAC Name | (2S)-N-[(3aR,4S,6aS)-2-(4-fluorophenyl)sulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]-2-(methylamino)hexanamide |
| SMILES | CCCC[C@H](NC)C(=O)N[C@H]1CC[C@@H]2CN(S(=O)(=O)c3ccc(F)cc3)C[C@@H]21 |
| InChI | InChI=1S/C20H30FN3O3S/c1-3-4-5-19(22-2)20(25)23-18-11-6-14-12-24(13-17(14)18)28(26,27)16-9-7-15(21)8-10-16/h7-10,14,17-19,22H,3-6,11-13H2,1-2H3,(H,23,25)/t14-,17+,18+,19+/m1/s1 |
| InChIKey | QPRGNLFPZTYYGD-FCLVOEFKSA-N |
| XLogP | 2.12 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.54 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |