C25H36F3N3O3S — CID 91061703
(2S)-N-[(3aR,4S,6aS)-2-[4-(trifluoromethyl)phenyl]sulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]-2-(cyclobutylamino)-4,4-dimethylpentanamide (PubChem CID 91061703) has the molecular formula C25H36F3N3O3S and a molecular weight of 515.64 g/mol. Its IUPAC name is (2S)-N-[(3aR,4S,6aS)-2-[4-(trifluoromethyl)phenyl]sulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]-2-(cyclobutylamino)-4,4-dimethylpentanamide.
| Compound Name | (2S)-N-[(3aR,4S,6aS)-2-[4-(trifluoromethyl)phenyl]sulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]-2-(cyclobutylamino)-4,4-dimethylpentanamide |
|---|---|
| PubChem CID | 91061703 |
| Molecular Formula | C25H36F3N3O3S |
| Molecular Weight | 515.64 g/mol |
| Exact Mass | 515.24 |
| IUPAC Name | (2S)-N-[(3aR,4S,6aS)-2-[4-(trifluoromethyl)phenyl]sulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]-2-(cyclobutylamino)-4,4-dimethylpentanamide |
| SMILES | CC(C)(C)C[C@H](NC1CCC1)C(=O)N[C@H]1CC[C@@H]2CN(S(=O)(=O)c3ccc(C(F)(F)F)cc3)C[C@@H]21 |
| InChI | InChI=1S/C25H36F3N3O3S/c1-24(2,3)13-22(29-18-5-4-6-18)23(32)30-21-12-7-16-14-31(15-20(16)21)35(33,34)19-10-8-17(9-11-19)25(26,27)28/h8-11,16,18,20-22,29H,4-7,12-15H2,1-3H3,(H,30,32)/t16-,20+,21+,22+/m1/s1 |
| InChIKey | FLZZKOYJFHRIFV-SEPFQZFQSA-N |
| XLogP | 4.17 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.64 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |