C22H32F3N3O3S — CID 91557545
(2S)-N-[(3aS,4R,6aR)-2-[3-(trifluoromethyl)phenyl]sulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]-4,4-dimethyl-2-(methylamino)pentanamide (PubChem CID 91557545) has the molecular formula C22H32F3N3O3S and a molecular weight of 475.58 g/mol. Its IUPAC name is (2S)-N-[(3aS,4R,6aR)-2-[3-(trifluoromethyl)phenyl]sulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]-4,4-dimethyl-2-(methylamino)pentanamide.
| Compound Name | (2S)-N-[(3aS,4R,6aR)-2-[3-(trifluoromethyl)phenyl]sulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]-4,4-dimethyl-2-(methylamino)pentanamide |
|---|---|
| PubChem CID | 91557545 |
| Molecular Formula | C22H32F3N3O3S |
| Molecular Weight | 475.58 g/mol |
| Exact Mass | 475.21 |
| IUPAC Name | (2S)-N-[(3aS,4R,6aR)-2-[3-(trifluoromethyl)phenyl]sulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]-4,4-dimethyl-2-(methylamino)pentanamide |
| SMILES | CN[C@@H](CC(C)(C)C)C(=O)N[C@@H]1CC[C@H]2CN(S(=O)(=O)c3cccc(C(F)(F)F)c3)C[C@H]21 |
| InChI | InChI=1S/C22H32F3N3O3S/c1-21(2,3)11-19(26-4)20(29)27-18-9-8-14-12-28(13-17(14)18)32(30,31)16-7-5-6-15(10-16)22(23,24)25/h5-7,10,14,17-19,26H,8-9,11-13H2,1-4H3,(H,27,29)/t14-,17+,18+,19-/m0/s1 |
| InChIKey | CSYNIUAYGHYVHJ-PIKADFDJSA-N |
| XLogP | 3.24 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.58 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |