C25H36F3N3O5S — CID 91135527
tert-butyl N-[(3R)-4-methyl-1-oxo-1-[[2-[3-(trifluoromethyl)phenyl]sulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]amino]pentan-3-yl]carbamate (PubChem CID 91135527) has the molecular formula C25H36F3N3O5S and a molecular weight of 547.64 g/mol. Its IUPAC name is tert-butyl N-[(3R)-4-methyl-1-oxo-1-[[2-[3-(trifluoromethyl)phenyl]sulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]amino]pentan-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R)-4-methyl-1-oxo-1-[[2-[3-(trifluoromethyl)phenyl]sulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]amino]pentan-3-yl]carbamate |
|---|---|
| PubChem CID | 91135527 |
| Molecular Formula | C25H36F3N3O5S |
| Molecular Weight | 547.64 g/mol |
| Exact Mass | 547.23 |
| IUPAC Name | tert-butyl N-[(3R)-4-methyl-1-oxo-1-[[2-[3-(trifluoromethyl)phenyl]sulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]amino]pentan-3-yl]carbamate |
| SMILES | CC(C)[C@@H](CC(=O)NC1CCC2CN(S(=O)(=O)c3cccc(C(F)(F)F)c3)CC21)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C25H36F3N3O5S/c1-15(2)21(30-23(33)36-24(3,4)5)12-22(32)29-20-10-9-16-13-31(14-19(16)20)37(34,35)18-8-6-7-17(11-18)25(26,27)28/h6-8,11,15-16,19-21H,9-10,12-14H2,1-5H3,(H,29,32)(H,30,33)/t16?,19?,20?,21-/m1/s1 |
| InChIKey | NWDZSHWLBWVURT-DPJLOUMZSA-N |
| XLogP | 4.16 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.64 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |