C19H24ClF3N2O4S — CID 66590111
tert-butyl N-[(3aR,4S,6aS)-2-[2-chloro-4-(trifluoromethyl)phenyl]sulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]carbamate (PubChem CID 66590111) has the molecular formula C19H24ClF3N2O4S and a molecular weight of 468.93 g/mol. Its IUPAC name is tert-butyl N-[(3aR,4S,6aS)-2-[2-chloro-4-(trifluoromethyl)phenyl]sulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]carbamate.
| Compound Name | tert-butyl N-[(3aR,4S,6aS)-2-[2-chloro-4-(trifluoromethyl)phenyl]sulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]carbamate |
|---|---|
| PubChem CID | 66590111 |
| Molecular Formula | C19H24ClF3N2O4S |
| Molecular Weight | 468.93 g/mol |
| Exact Mass | 468.11 |
| IUPAC Name | tert-butyl N-[(3aR,4S,6aS)-2-[2-chloro-4-(trifluoromethyl)phenyl]sulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CC[C@@H]2CN(S(=O)(=O)c3ccc(C(F)(F)F)cc3Cl)C[C@@H]21 |
| InChI | InChI=1S/C19H24ClF3N2O4S/c1-18(2,3)29-17(26)24-15-6-4-11-9-25(10-13(11)15)30(27,28)16-7-5-12(8-14(16)20)19(21,22)23/h5,7-8,11,13,15H,4,6,9-10H2,1-3H3,(H,24,26)/t11-,13+,15+/m1/s1 |
| InChIKey | POQKYGPCFFCILY-ZLDLUXBVSA-N |
| XLogP | 4.28 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.93 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |