C24H32F3N3O5S — CID 66590187
tert-butyl 2-[[(3aS,4R,6aR)-2-[3-(trifluoromethyl)phenyl]sulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]carbamoyl]pyrrolidine-1-carboxylate (PubChem CID 66590187) has the molecular formula C24H32F3N3O5S and a molecular weight of 531.60 g/mol. Its IUPAC name is tert-butyl 2-[[(3aS,4R,6aR)-2-[3-(trifluoromethyl)phenyl]sulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]carbamoyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-[[(3aS,4R,6aR)-2-[3-(trifluoromethyl)phenyl]sulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]carbamoyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 66590187 |
| Molecular Formula | C24H32F3N3O5S |
| Molecular Weight | 531.60 g/mol |
| Exact Mass | 531.20 |
| IUPAC Name | tert-butyl 2-[[(3aS,4R,6aR)-2-[3-(trifluoromethyl)phenyl]sulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]carbamoyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC1C(=O)N[C@@H]1CC[C@H]2CN(S(=O)(=O)c3cccc(C(F)(F)F)c3)C[C@H]21 |
| InChI | InChI=1S/C24H32F3N3O5S/c1-23(2,3)35-22(32)30-11-5-8-20(30)21(31)28-19-10-9-15-13-29(14-18(15)19)36(33,34)17-7-4-6-16(12-17)24(25,26)27/h4,6-7,12,15,18-20H,5,8-11,13-14H2,1-3H3,(H,28,31)/t15-,18+,19+,20?/m0/s1 |
| InChIKey | GBNNXCPCMMEXLB-RBMMPJQBSA-N |
| XLogP | 3.62 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.60 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |