C24H34F3N3O4S — CID 54674156
(2S)-N-[(3aS,4R,6aR)-2-[3-(trifluoromethyl)phenyl]sulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]-4-methyl-2-morpholin-4-ylpentanamide (PubChem CID 54674156) has the molecular formula C24H34F3N3O4S and a molecular weight of 517.61 g/mol. Its IUPAC name is (2S)-N-[(3aS,4R,6aR)-2-[3-(trifluoromethyl)phenyl]sulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]-4-methyl-2-morpholin-4-ylpentanamide.
| Compound Name | (2S)-N-[(3aS,4R,6aR)-2-[3-(trifluoromethyl)phenyl]sulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]-4-methyl-2-morpholin-4-ylpentanamide |
|---|---|
| PubChem CID | 54674156 |
| Molecular Formula | C24H34F3N3O4S |
| Molecular Weight | 517.61 g/mol |
| Exact Mass | 517.22 |
| IUPAC Name | (2S)-N-[(3aS,4R,6aR)-2-[3-(trifluoromethyl)phenyl]sulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]-4-methyl-2-morpholin-4-ylpentanamide |
| SMILES | CC(C)C[C@@H](C(=O)N[C@@H]1CC[C@H]2CN(S(=O)(=O)c3cccc(C(F)(F)F)c3)C[C@H]21)N1CCOCC1 |
| InChI | InChI=1S/C24H34F3N3O4S/c1-16(2)12-22(29-8-10-34-11-9-29)23(31)28-21-7-6-17-14-30(15-20(17)21)35(32,33)19-5-3-4-18(13-19)24(25,26)27/h3-5,13,16-17,20-22H,6-12,14-15H2,1-2H3,(H,28,31)/t17-,20+,21+,22-/m0/s1 |
| InChIKey | ILKHGRYOCFZOEV-UPZYVNNASA-N |
| XLogP | 2.97 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.61 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |