C21H30F3N3O3S — CID 91073995
(2S,3S)-N-[(3aS,4R,6aR)-2-[4-(trifluoromethyl)phenyl]sulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]-3-methyl-2-(methylamino)pentanamide (PubChem CID 91073995) has the molecular formula C21H30F3N3O3S and a molecular weight of 461.55 g/mol. Its IUPAC name is (2S,3S)-N-[(3aS,4R,6aR)-2-[4-(trifluoromethyl)phenyl]sulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]-3-methyl-2-(methylamino)pentanamide.
| Compound Name | (2S,3S)-N-[(3aS,4R,6aR)-2-[4-(trifluoromethyl)phenyl]sulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]-3-methyl-2-(methylamino)pentanamide |
|---|---|
| PubChem CID | 91073995 |
| Molecular Formula | C21H30F3N3O3S |
| Molecular Weight | 461.55 g/mol |
| Exact Mass | 461.20 |
| IUPAC Name | (2S,3S)-N-[(3aS,4R,6aR)-2-[4-(trifluoromethyl)phenyl]sulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]-3-methyl-2-(methylamino)pentanamide |
| SMILES | CC[C@H](C)[C@H](NC)C(=O)N[C@@H]1CC[C@H]2CN(S(=O)(=O)c3ccc(C(F)(F)F)cc3)C[C@H]21 |
| InChI | InChI=1S/C21H30F3N3O3S/c1-4-13(2)19(25-3)20(28)26-18-10-5-14-11-27(12-17(14)18)31(29,30)16-8-6-15(7-9-16)21(22,23)24/h6-9,13-14,17-19,25H,4-5,10-12H2,1-3H3,(H,26,28)/t13-,14-,17+,18+,19-/m0/s1 |
| InChIKey | SUMBLOLXNUHCMS-JCTKKGROSA-N |
| XLogP | 2.85 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.55 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |