C23H32F3N3O3S — CID 46213817
(2S)-N-[(3aR,4S,6aS)-2-[4-(trifluoromethyl)phenyl]sulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]-2-amino-3-cyclohexylpropanamide (PubChem CID 46213817) has the molecular formula C23H32F3N3O3S and a molecular weight of 487.59 g/mol. Its IUPAC name is (2S)-N-[(3aR,4S,6aS)-2-[4-(trifluoromethyl)phenyl]sulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]-2-amino-3-cyclohexylpropanamide.
| Compound Name | (2S)-N-[(3aR,4S,6aS)-2-[4-(trifluoromethyl)phenyl]sulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]-2-amino-3-cyclohexylpropanamide |
|---|---|
| PubChem CID | 46213817 |
| Molecular Formula | C23H32F3N3O3S |
| Molecular Weight | 487.59 g/mol |
| Exact Mass | 487.21 |
| IUPAC Name | (2S)-N-[(3aR,4S,6aS)-2-[4-(trifluoromethyl)phenyl]sulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]-2-amino-3-cyclohexylpropanamide |
| SMILES | N[C@@H](CC1CCCCC1)C(=O)N[C@H]1CC[C@@H]2CN(S(=O)(=O)c3ccc(C(F)(F)F)cc3)C[C@@H]21 |
| InChI | InChI=1S/C23H32F3N3O3S/c24-23(25,26)17-7-9-18(10-8-17)33(31,32)29-13-16-6-11-21(19(16)14-29)28-22(30)20(27)12-15-4-2-1-3-5-15/h7-10,15-16,19-21H,1-6,11-14,27H2,(H,28,30)/t16-,19+,20+,21+/m1/s1 |
| InChIKey | YZTBBGZTFCBLAL-SEVLPDGMSA-N |
| XLogP | 3.52 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.59 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |