C21H30F3N3O3S — CID 66590739
(2S)-N-[(3aS,4S,6aR)-2-[4-(trifluoromethyl)phenyl]sulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]-2-amino-N,4-dimethylpentanamide (PubChem CID 66590739) has the molecular formula C21H30F3N3O3S and a molecular weight of 461.55 g/mol. Its IUPAC name is (2S)-N-[(3aS,4S,6aR)-2-[4-(trifluoromethyl)phenyl]sulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]-2-amino-N,4-dimethylpentanamide.
| Compound Name | (2S)-N-[(3aS,4S,6aR)-2-[4-(trifluoromethyl)phenyl]sulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]-2-amino-N,4-dimethylpentanamide |
|---|---|
| PubChem CID | 66590739 |
| Molecular Formula | C21H30F3N3O3S |
| Molecular Weight | 461.55 g/mol |
| Exact Mass | 461.20 |
| IUPAC Name | (2S)-N-[(3aS,4S,6aR)-2-[4-(trifluoromethyl)phenyl]sulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]-2-amino-N,4-dimethylpentanamide |
| SMILES | CC(C)C[C@H](N)C(=O)N(C)[C@H]1CC[C@H]2CN(S(=O)(=O)c3ccc(C(F)(F)F)cc3)C[C@H]21 |
| InChI | InChI=1S/C21H30F3N3O3S/c1-13(2)10-18(25)20(28)26(3)19-9-4-14-11-27(12-17(14)19)31(29,30)16-7-5-15(6-8-16)21(22,23)24/h5-8,13-14,17-19H,4,9-12,25H2,1-3H3/t14-,17+,18-,19-/m0/s1 |
| InChIKey | CYUIXRQDDFKMOY-VLQPXKRTSA-N |
| XLogP | 2.94 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.55 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |