C24H36FN3O5S — CID 66591034
[(2S)-1-[[(3aR,4S,6aS)-2-(4-fluorophenyl)sulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]amino]-3,5,5-trimethyl-1-oxohexan-2-yl]-methylcarbamic acid (PubChem CID 66591034) has the molecular formula C24H36FN3O5S and a molecular weight of 497.63 g/mol. Its IUPAC name is [(2S)-1-[[(3aR,4S,6aS)-2-(4-fluorophenyl)sulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]amino]-3,5,5-trimethyl-1-oxohexan-2-yl]-methylcarbamic acid.
| Compound Name | [(2S)-1-[[(3aR,4S,6aS)-2-(4-fluorophenyl)sulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]amino]-3,5,5-trimethyl-1-oxohexan-2-yl]-methylcarbamic acid |
|---|---|
| PubChem CID | 66591034 |
| Molecular Formula | C24H36FN3O5S |
| Molecular Weight | 497.63 g/mol |
| Exact Mass | 497.24 |
| IUPAC Name | [(2S)-1-[[(3aR,4S,6aS)-2-(4-fluorophenyl)sulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]amino]-3,5,5-trimethyl-1-oxohexan-2-yl]-methylcarbamic acid |
| SMILES | CC(CC(C)(C)C)[C@@H](C(=O)N[C@H]1CC[C@@H]2CN(S(=O)(=O)c3ccc(F)cc3)C[C@@H]21)N(C)C(=O)O |
| InChI | InChI=1S/C24H36FN3O5S/c1-15(12-24(2,3)4)21(27(5)23(30)31)22(29)26-20-11-6-16-13-28(14-19(16)20)34(32,33)18-9-7-17(25)8-10-18/h7-10,15-16,19-21H,6,11-14H2,1-5H3,(H,26,29)(H,30,31)/t15?,16-,19+,20+,21+/m1/s1 |
| InChIKey | CSCGTJUKSLOASH-SOSHZCIPSA-N |
| XLogP | 3.39 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.63 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |