C21H30FN3O5S — CID 68565513
[(4S)-5-[[(3aS,4R,6aR)-2-(4-fluorophenyl)sulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]amino]-4-methyl-5-oxopentan-2-yl]-methylcarbamic acid (PubChem CID 68565513) has the molecular formula C21H30FN3O5S and a molecular weight of 455.55 g/mol. Its IUPAC name is [(4S)-5-[[(3aS,4R,6aR)-2-(4-fluorophenyl)sulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]amino]-4-methyl-5-oxopentan-2-yl]-methylcarbamic acid.
| Compound Name | [(4S)-5-[[(3aS,4R,6aR)-2-(4-fluorophenyl)sulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]amino]-4-methyl-5-oxopentan-2-yl]-methylcarbamic acid |
|---|---|
| PubChem CID | 68565513 |
| Molecular Formula | C21H30FN3O5S |
| Molecular Weight | 455.55 g/mol |
| Exact Mass | 455.19 |
| IUPAC Name | [(4S)-5-[[(3aS,4R,6aR)-2-(4-fluorophenyl)sulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]amino]-4-methyl-5-oxopentan-2-yl]-methylcarbamic acid |
| SMILES | CC(C[C@H](C)C(=O)N[C@@H]1CC[C@H]2CN(S(=O)(=O)c3ccc(F)cc3)C[C@H]21)N(C)C(=O)O |
| InChI | InChI=1S/C21H30FN3O5S/c1-13(10-14(2)24(3)21(27)28)20(26)23-19-9-4-15-11-25(12-18(15)19)31(29,30)17-7-5-16(22)6-8-17/h5-8,13-15,18-19H,4,9-12H2,1-3H3,(H,23,26)(H,27,28)/t13-,14?,15-,18+,19+/m0/s1 |
| InChIKey | WEHQTUWMCLWHFJ-ZGPSSNJQSA-N |
| XLogP | 2.37 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.55 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |