C24H36FN3O5S — CID 66590673
[(2S)-1-[[(3aS,4R,6aR)-2-(4-fluorophenyl)sulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]amino]-6,6-dimethyl-1-oxoheptan-2-yl]-methylcarbamic acid (PubChem CID 66590673) has the molecular formula C24H36FN3O5S and a molecular weight of 497.63 g/mol. Its IUPAC name is [(2S)-1-[[(3aS,4R,6aR)-2-(4-fluorophenyl)sulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]amino]-6,6-dimethyl-1-oxoheptan-2-yl]-methylcarbamic acid.
| Compound Name | [(2S)-1-[[(3aS,4R,6aR)-2-(4-fluorophenyl)sulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]amino]-6,6-dimethyl-1-oxoheptan-2-yl]-methylcarbamic acid |
|---|---|
| PubChem CID | 66590673 |
| Molecular Formula | C24H36FN3O5S |
| Molecular Weight | 497.63 g/mol |
| Exact Mass | 497.24 |
| IUPAC Name | [(2S)-1-[[(3aS,4R,6aR)-2-(4-fluorophenyl)sulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]amino]-6,6-dimethyl-1-oxoheptan-2-yl]-methylcarbamic acid |
| SMILES | CN(C(=O)O)[C@@H](CCCC(C)(C)C)C(=O)N[C@@H]1CC[C@H]2CN(S(=O)(=O)c3ccc(F)cc3)C[C@H]21 |
| InChI | InChI=1S/C24H36FN3O5S/c1-24(2,3)13-5-6-21(27(4)23(30)31)22(29)26-20-12-7-16-14-28(15-19(16)20)34(32,33)18-10-8-17(25)9-11-18/h8-11,16,19-21H,5-7,12-15H2,1-4H3,(H,26,29)(H,30,31)/t16-,19+,20+,21-/m0/s1 |
| InChIKey | FEECWSRCVLSAOZ-ZXNZYJFHSA-N |
| XLogP | 3.54 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.63 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |