C25H38FN3O5S — CID 87230847
[(1S)-1-[[(3aS,4R,6aR)-2-(4-fluorophenyl)sulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]amino]-2-formyl-4-methylpentyl]-tert-butylcarbamic acid (PubChem CID 87230847) has the molecular formula C25H38FN3O5S and a molecular weight of 511.66 g/mol. Its IUPAC name is [(1S)-1-[[(3aS,4R,6aR)-2-(4-fluorophenyl)sulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]amino]-2-formyl-4-methylpentyl]-tert-butylcarbamic acid.
| Compound Name | [(1S)-1-[[(3aS,4R,6aR)-2-(4-fluorophenyl)sulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]amino]-2-formyl-4-methylpentyl]-tert-butylcarbamic acid |
|---|---|
| PubChem CID | 87230847 |
| Molecular Formula | C25H38FN3O5S |
| Molecular Weight | 511.66 g/mol |
| Exact Mass | 511.25 |
| IUPAC Name | [(1S)-1-[[(3aS,4R,6aR)-2-(4-fluorophenyl)sulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]amino]-2-formyl-4-methylpentyl]-tert-butylcarbamic acid |
| SMILES | CC(C)CC(C=O)[C@@H](N[C@@H]1CC[C@H]2CN(S(=O)(=O)c3ccc(F)cc3)C[C@H]21)N(C(=O)O)C(C)(C)C |
| InChI | InChI=1S/C25H38FN3O5S/c1-16(2)12-18(15-30)23(29(24(31)32)25(3,4)5)27-22-11-6-17-13-28(14-21(17)22)35(33,34)20-9-7-19(26)8-10-20/h7-10,15-18,21-23,27H,6,11-14H2,1-5H3,(H,31,32)/t17-,18?,21+,22+,23-/m0/s1 |
| InChIKey | RWACYMQXTOMJDX-ZPBJYJACSA-N |
| XLogP | 3.78 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.66 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|