C20H31N3O4 — CID 70088963
benzyl N-[(3S)-5-[(3-hydroxyazepan-4-yl)amino]-3-methyl-5-oxopentyl]carbamate (PubChem CID 70088963) has the molecular formula C20H31N3O4 and a molecular weight of 377.49 g/mol. Its IUPAC name is benzyl N-[(3S)-5-[(3-hydroxyazepan-4-yl)amino]-3-methyl-5-oxopentyl]carbamate.
| Compound Name | benzyl N-[(3S)-5-[(3-hydroxyazepan-4-yl)amino]-3-methyl-5-oxopentyl]carbamate |
|---|---|
| PubChem CID | 70088963 |
| Molecular Formula | C20H31N3O4 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.23 |
| IUPAC Name | benzyl N-[(3S)-5-[(3-hydroxyazepan-4-yl)amino]-3-methyl-5-oxopentyl]carbamate |
| SMILES | C[C@@H](CCNC(=O)OCc1ccccc1)CC(=O)NC1CCCNCC1O |
| InChI | InChI=1S/C20H31N3O4/c1-15(12-19(25)23-17-8-5-10-21-13-18(17)24)9-11-22-20(26)27-14-16-6-3-2-4-7-16/h2-4,6-7,15,17-18,21,24H,5,8-14H2,1H3,(H,22,26)(H,23,25)/t15-,17?,18?/m0/s1 |
| InChIKey | TZXMKJKWRVETMK-ZLPCBKJTSA-N |
| XLogP | 1.56 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |