C25H32N2O7 — CID 90003955
dibenzyl 2,3-dihydroxybutanedioate;N-[(3R)-piperidin-3-yl]acetamide (PubChem CID 90003955) has the molecular formula C25H32N2O7 and a molecular weight of 472.54 g/mol. Its IUPAC name is dibenzyl 2,3-dihydroxybutanedioate;N-[(3R)-piperidin-3-yl]acetamide.
| Compound Name | dibenzyl 2,3-dihydroxybutanedioate;N-[(3R)-piperidin-3-yl]acetamide |
|---|---|
| PubChem CID | 90003955 |
| Molecular Formula | C25H32N2O7 |
| Molecular Weight | 472.54 g/mol |
| Exact Mass | 472.22 |
| IUPAC Name | dibenzyl 2,3-dihydroxybutanedioate;N-[(3R)-piperidin-3-yl]acetamide |
| SMILES | CC(=O)N[C@@H]1CCCNC1.O=C(OCc1ccccc1)C(O)C(O)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C18H18O6.C7H14N2O/c19-15(17(21)23-11-13-7-3-1-4-8-13)16(20)18(22)24-12-14-9-5-2-6-10-14;1-6(10)9-7-3-2-4-8-5-7/h1-10,15-16,19-20H,11-12H2;7-8H,2-5H2,1H3,(H,9,10)/t;7-/m.1/s1 |
| InChIKey | GPVUVJGNVPKIHA-HMZWWLAASA-N |
| XLogP | 1.07 |
| TPSA | 134.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.54 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |