C11H12BrNO4 — CID 103879318
methyl 3-[(2-bromobenzoyl)amino]-2-hydroxypropanoate (PubChem CID 103879318) has the molecular formula C11H12BrNO4 and a molecular weight of 302.12 g/mol. Its IUPAC name is methyl 3-[(2-bromobenzoyl)amino]-2-hydroxypropanoate.
| Compound Name | methyl 3-[(2-bromobenzoyl)amino]-2-hydroxypropanoate |
|---|---|
| PubChem CID | 103879318 |
| Molecular Formula | C11H12BrNO4 |
| Molecular Weight | 302.12 g/mol |
| Exact Mass | 300.99 |
| IUPAC Name | methyl 3-[(2-bromobenzoyl)amino]-2-hydroxypropanoate |
| SMILES | COC(=O)C(O)CNC(=O)c1ccccc1Br |
| InChI | InChI=1S/C11H12BrNO4/c1-17-11(16)9(14)6-13-10(15)7-4-2-3-5-8(7)12/h2-5,9,14H,6H2,1H3,(H,13,15) |
| InChIKey | ZMTCIBIKJJGPEK-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.12 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |