C10H11N3O — CID 61253687
2-amino-N-(cyanomethyl)-2-phenylacetamide (PubChem CID 61253687) has the molecular formula C10H11N3O and a molecular weight of 189.22 g/mol. Its IUPAC name is 2-amino-N-(cyanomethyl)-2-phenylacetamide.
| Compound Name | 2-amino-N-(cyanomethyl)-2-phenylacetamide |
|---|---|
| PubChem CID | 61253687 |
| Molecular Formula | C10H11N3O |
| Molecular Weight | 189.22 g/mol |
| Exact Mass | 189.09 |
| IUPAC Name | 2-amino-N-(cyanomethyl)-2-phenylacetamide |
| SMILES | N#CCNC(=O)C(N)c1ccccc1 |
| InChI | InChI=1S/C10H11N3O/c11-6-7-13-10(14)9(12)8-4-2-1-3-5-8/h1-5,9H,7,12H2,(H,13,14) |
| InChIKey | GTLYYIAWFABXLI-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.22 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|