C12H16N2O4 — CID 107836300
(2S)-4-[[(2S)-2-amino-2-phenylacetyl]amino]-2-hydroxybutanoic acid (PubChem CID 107836300) has the molecular formula C12H16N2O4 and a molecular weight of 252.27 g/mol. Its IUPAC name is (2S)-4-[[(2S)-2-amino-2-phenylacetyl]amino]-2-hydroxybutanoic acid.
| Compound Name | (2S)-4-[[(2S)-2-amino-2-phenylacetyl]amino]-2-hydroxybutanoic acid |
|---|---|
| PubChem CID | 107836300 |
| Molecular Formula | C12H16N2O4 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | (2S)-4-[[(2S)-2-amino-2-phenylacetyl]amino]-2-hydroxybutanoic acid |
| SMILES | N[C@H](C(=O)NCC[C@H](O)C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C12H16N2O4/c13-10(8-4-2-1-3-5-8)11(16)14-7-6-9(15)12(17)18/h1-5,9-10,15H,6-7,13H2,(H,14,16)(H,17,18)/t9-,10-/m0/s1 |
| InChIKey | QXECHDZAPRTAFL-UWVGGRQHSA-N |
| XLogP | -0.36 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |