C7H14N2O4 — CID 107836163
4-[[(2S)-2-aminopropanoyl]amino]-2-hydroxybutanoic acid (PubChem CID 107836163) has the molecular formula C7H14N2O4 and a molecular weight of 190.20 g/mol. Its IUPAC name is 4-[[(2S)-2-aminopropanoyl]amino]-2-hydroxybutanoic acid.
| Compound Name | 4-[[(2S)-2-aminopropanoyl]amino]-2-hydroxybutanoic acid |
|---|---|
| PubChem CID | 107836163 |
| Molecular Formula | C7H14N2O4 |
| Molecular Weight | 190.20 g/mol |
| Exact Mass | 190.10 |
| IUPAC Name | 4-[[(2S)-2-aminopropanoyl]amino]-2-hydroxybutanoic acid |
| SMILES | C[C@H](N)C(=O)NCCC(O)C(=O)O |
| InChI | InChI=1S/C7H14N2O4/c1-4(8)6(11)9-3-2-5(10)7(12)13/h4-5,10H,2-3,8H2,1H3,(H,9,11)(H,12,13)/t4-,5?/m0/s1 |
| InChIKey | MNYFCNVDUAXECR-ROLXFIACSA-N |
| XLogP | -1.71 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.20 |
| LogP ≤ 5 | -1.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |