C14H17O2- — CID 6931336
(2R)-2-cyclohexyl-2-phenylacetate (PubChem CID 6931336) has the molecular formula C14H17O2- and a molecular weight of 217.29 g/mol. Its IUPAC name is (2R)-2-cyclohexyl-2-phenylacetate.
| Compound Name | (2R)-2-cyclohexyl-2-phenylacetate |
|---|---|
| PubChem CID | 6931336 |
| Molecular Formula | C14H17O2- |
| Molecular Weight | 217.29 g/mol |
| Exact Mass | 217.12 |
| IUPAC Name | (2R)-2-cyclohexyl-2-phenylacetate |
| SMILES | O=C([O-])[C@@H](c1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C14H18O2/c15-14(16)13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1,3-4,7-8,12-13H,2,5-6,9-10H2,(H,15,16)/p-1/t13-/m0/s1 |
| InChIKey | AAJLPPDFIRPBDA-ZDUSSCGKSA-M |
| XLogP | 2.10 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.29 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |