C17H26O5 — CID 175204467
2-cyclopentyl-2-phenylacetic acid;2-(2-hydroxyethoxy)ethanol (PubChem CID 175204467) has the molecular formula C17H26O5 and a molecular weight of 310.39 g/mol. Its IUPAC name is 2-cyclopentyl-2-phenylacetic acid;2-(2-hydroxyethoxy)ethanol.
| Compound Name | 2-cyclopentyl-2-phenylacetic acid;2-(2-hydroxyethoxy)ethanol |
|---|---|
| PubChem CID | 175204467 |
| Molecular Formula | C17H26O5 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | 2-cyclopentyl-2-phenylacetic acid;2-(2-hydroxyethoxy)ethanol |
| SMILES | O=C(O)C(c1ccccc1)C1CCCC1.OCCOCCO |
| InChI | InChI=1S/C13H16O2.C4H10O3/c14-13(15)12(11-8-4-5-9-11)10-6-2-1-3-7-10;5-1-3-7-4-2-6/h1-3,6-7,11-12H,4-5,8-9H2,(H,14,15);5-6H,1-4H2 |
| InChIKey | ZHNRTADHMLPHHY-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|