C21H34BrNO2 — CID 21149401
2-(2-cyclohexyl-2-phenylacetyl)oxyethyl-diethyl-methylazanium bromide (PubChem CID 21149401) has the molecular formula C21H34BrNO2 and a molecular weight of 412.41 g/mol. Its IUPAC name is 2-(2-cyclohexyl-2-phenylacetyl)oxyethyl-diethyl-methylazanium bromide.
| Compound Name | 2-(2-cyclohexyl-2-phenylacetyl)oxyethyl-diethyl-methylazanium bromide |
|---|---|
| PubChem CID | 21149401 |
| Molecular Formula | C21H34BrNO2 |
| Molecular Weight | 412.41 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | 2-(2-cyclohexyl-2-phenylacetyl)oxyethyl-diethyl-methylazanium bromide |
| SMILES | CC[N+](C)(CC)CCOC(=O)C(c1ccccc1)C1CCCCC1.[Br-] |
| InChI | InChI=1S/C21H34NO2.BrH/c1-4-22(3,5-2)16-17-24-21(23)20(18-12-8-6-9-13-18)19-14-10-7-11-15-19;/h6,8-9,12-13,19-20H,4-5,7,10-11,14-17H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | FYRDBUULLGFMLL-UHFFFAOYSA-M |
| XLogP | 1.38 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.41 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|