C22H30BrNO2 — CID 3028235
2-(2,2-diphenylacetyl)oxyethyl-triethylazanium bromide (PubChem CID 3028235) has the molecular formula C22H30BrNO2 and a molecular weight of 420.39 g/mol. Its IUPAC name is 2-(2,2-diphenylacetyl)oxyethyl-triethylazanium bromide.
| Compound Name | 2-(2,2-diphenylacetyl)oxyethyl-triethylazanium bromide |
|---|---|
| PubChem CID | 3028235 |
| Molecular Formula | C22H30BrNO2 |
| Molecular Weight | 420.39 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | 2-(2,2-diphenylacetyl)oxyethyl-triethylazanium bromide |
| SMILES | CC[N+](CC)(CC)CCOC(=O)C(c1ccccc1)c1ccccc1.[Br-] |
| InChI | InChI=1S/C22H30NO2.BrH/c1-4-23(5-2,6-3)17-18-25-22(24)21(19-13-9-7-10-14-19)20-15-11-8-12-16-20;/h7-16,21H,4-6,17-18H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | LXUXSZVNTNRQEJ-UHFFFAOYSA-M |
| XLogP | 1.24 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.39 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|