C24H26NO2+ — CID 3753833
2-(2,4,6-trimethylpyridin-1-ium-1-yl)ethyl 2,2-diphenylacetate (PubChem CID 3753833) has the molecular formula C24H26NO2+ and a molecular weight of 360.48 g/mol. Its IUPAC name is 2-(2,4,6-trimethylpyridin-1-ium-1-yl)ethyl 2,2-diphenylacetate.
| Compound Name | 2-(2,4,6-trimethylpyridin-1-ium-1-yl)ethyl 2,2-diphenylacetate |
|---|---|
| PubChem CID | 3753833 |
| Molecular Formula | C24H26NO2+ |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | 2-(2,4,6-trimethylpyridin-1-ium-1-yl)ethyl 2,2-diphenylacetate |
| SMILES | Cc1cc(C)[n+](CCOC(=O)C(c2ccccc2)c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C24H26NO2/c1-18-16-19(2)25(20(3)17-18)14-15-27-24(26)23(21-10-6-4-7-11-21)22-12-8-5-9-13-22/h4-13,16-17,23H,14-15H2,1-3H3/q+1 |
| InChIKey | DHJZYZKZHKAZBC-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|