C20H26ClNO2 — CID 657315
2-(diethylamino)ethyl 2,2-diphenylacetate;hydron;chloride (PubChem CID 657315) has the molecular formula C20H26ClNO2 and a molecular weight of 347.89 g/mol. Its IUPAC name is 2-(diethylamino)ethyl 2,2-diphenylacetate;hydron;chloride.
| Compound Name | 2-(diethylamino)ethyl 2,2-diphenylacetate;hydron;chloride |
|---|---|
| PubChem CID | 657315 |
| Molecular Formula | C20H26ClNO2 |
| Molecular Weight | 347.89 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | 2-(diethylamino)ethyl 2,2-diphenylacetate;hydron;chloride |
| SMILES | CCN(CC)CCOC(=O)C(c1ccccc1)c1ccccc1.[Cl-].[H+] |
| InChI | InChI=1S/C20H25NO2.ClH/c1-3-21(4-2)15-16-23-20(22)19(17-11-7-5-8-12-17)18-13-9-6-10-14-18;/h5-14,19H,3-4,15-16H2,1-2H3;1H |
| InChIKey | LKPINBXAWIMZCG-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.89 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |