C24H34N2O — CID 3026496
N-[3-(diethylamino)propyl]-2,2-diphenyl-N-propan-2-ylacetamide (PubChem CID 3026496) has the molecular formula C24H34N2O and a molecular weight of 366.55 g/mol. Its IUPAC name is N-[3-(diethylamino)propyl]-2,2-diphenyl-N-propan-2-ylacetamide.
| Compound Name | N-[3-(diethylamino)propyl]-2,2-diphenyl-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 3026496 |
| Molecular Formula | C24H34N2O |
| Molecular Weight | 366.55 g/mol |
| Exact Mass | 366.27 |
| IUPAC Name | N-[3-(diethylamino)propyl]-2,2-diphenyl-N-propan-2-ylacetamide |
| SMILES | CCN(CC)CCCN(C(=O)C(c1ccccc1)c1ccccc1)C(C)C |
| InChI | InChI=1S/C24H34N2O/c1-5-25(6-2)18-13-19-26(20(3)4)24(27)23(21-14-9-7-10-15-21)22-16-11-8-12-17-22/h7-12,14-17,20,23H,5-6,13,18-19H2,1-4H3 |
| InChIKey | PAVWZRNAKXICRO-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.55 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |