C17H21ClN2O — CID 139747660
2,2-diphenyl-N-propylacetohydrazide;hydrochloride (PubChem CID 139747660) has the molecular formula C17H21ClN2O and a molecular weight of 304.82 g/mol. Its IUPAC name is 2,2-diphenyl-N-propylacetohydrazide;hydrochloride.
| Compound Name | 2,2-diphenyl-N-propylacetohydrazide;hydrochloride |
|---|---|
| PubChem CID | 139747660 |
| Molecular Formula | C17H21ClN2O |
| Molecular Weight | 304.82 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | 2,2-diphenyl-N-propylacetohydrazide;hydrochloride |
| SMILES | CCCN(N)C(=O)C(c1ccccc1)c1ccccc1.Cl |
| InChI | InChI=1S/C17H20N2O.ClH/c1-2-13-19(18)17(20)16(14-9-5-3-6-10-14)15-11-7-4-8-12-15;/h3-12,16H,2,13,18H2,1H3;1H |
| InChIKey | HFAKKHMUTBMWFU-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.82 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|