C19H23NO2 — CID 111695707
N-(3-hydroxybutyl)-N-methyl-2,2-diphenylacetamide (PubChem CID 111695707) has the molecular formula C19H23NO2 and a molecular weight of 297.40 g/mol. Its IUPAC name is N-(3-hydroxybutyl)-N-methyl-2,2-diphenylacetamide.
| Compound Name | N-(3-hydroxybutyl)-N-methyl-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 111695707 |
| Molecular Formula | C19H23NO2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | N-(3-hydroxybutyl)-N-methyl-2,2-diphenylacetamide |
| SMILES | CC(O)CCN(C)C(=O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H23NO2/c1-15(21)13-14-20(2)19(22)18(16-9-5-3-6-10-16)17-11-7-4-8-12-17/h3-12,15,18,21H,13-14H2,1-2H3 |
| InChIKey | JUEIDAVFUWGQFO-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |