C22H32ClN3O — CID 138396549
4-amino-N-[3-(diethylamino)propyl]-N-(1-phenylethyl)benzamide;hydrochloride (PubChem CID 138396549) has the molecular formula C22H32ClN3O and a molecular weight of 389.97 g/mol. Its IUPAC name is 4-amino-N-[3-(diethylamino)propyl]-N-(1-phenylethyl)benzamide;hydrochloride.
| Compound Name | 4-amino-N-[3-(diethylamino)propyl]-N-(1-phenylethyl)benzamide;hydrochloride |
|---|---|
| PubChem CID | 138396549 |
| Molecular Formula | C22H32ClN3O |
| Molecular Weight | 389.97 g/mol |
| Exact Mass | 389.22 |
| IUPAC Name | 4-amino-N-[3-(diethylamino)propyl]-N-(1-phenylethyl)benzamide;hydrochloride |
| SMILES | CCN(CC)CCCN(C(=O)c1ccc(N)cc1)C(C)c1ccccc1.Cl |
| InChI | InChI=1S/C22H31N3O.ClH/c1-4-24(5-2)16-9-17-25(18(3)19-10-7-6-8-11-19)22(26)20-12-14-21(23)15-13-20;/h6-8,10-15,18H,4-5,9,16-17,23H2,1-3H3;1H |
| InChIKey | DHYXMCWSJRUEHF-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.97 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|