C27H38BrNO3 — CID 134828179
benzyl-diethyl-[2-[2-(1-hydroxycyclohexyl)-2-phenylacetyl]oxyethyl]azanium bromide (PubChem CID 134828179) has the molecular formula C27H38BrNO3 and a molecular weight of 504.51 g/mol. Its IUPAC name is benzyl-diethyl-[2-[2-(1-hydroxycyclohexyl)-2-phenylacetyl]oxyethyl]azanium bromide.
| Compound Name | benzyl-diethyl-[2-[2-(1-hydroxycyclohexyl)-2-phenylacetyl]oxyethyl]azanium bromide |
|---|---|
| PubChem CID | 134828179 |
| Molecular Formula | C27H38BrNO3 |
| Molecular Weight | 504.51 g/mol |
| Exact Mass | 503.20 |
| IUPAC Name | benzyl-diethyl-[2-[2-(1-hydroxycyclohexyl)-2-phenylacetyl]oxyethyl]azanium bromide |
| SMILES | CC[N+](CC)(CCOC(=O)C(c1ccccc1)C1(O)CCCCC1)Cc1ccccc1.[Br-] |
| InChI | InChI=1S/C27H38NO3.BrH/c1-3-28(4-2,22-23-14-8-5-9-15-23)20-21-31-26(29)25(24-16-10-6-11-17-24)27(30)18-12-7-13-19-27;/h5-6,8-11,14-17,25,30H,3-4,7,12-13,18-22H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | LRNRVHFQCYHIGB-UHFFFAOYSA-M |
| XLogP | 2.07 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.51 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|