C19H32NO2+ — CID 38989053
diethyl-methyl-[2-[(2R,3R)-3-methyl-2-phenylpentanoyl]oxyethyl]azanium (PubChem CID 38989053) has the molecular formula C19H32NO2+ and a molecular weight of 306.47 g/mol. Its IUPAC name is diethyl-methyl-[2-[(2R,3R)-3-methyl-2-phenylpentanoyl]oxyethyl]azanium.
| Compound Name | diethyl-methyl-[2-[(2R,3R)-3-methyl-2-phenylpentanoyl]oxyethyl]azanium |
|---|---|
| PubChem CID | 38989053 |
| Molecular Formula | C19H32NO2+ |
| Molecular Weight | 306.47 g/mol |
| Exact Mass | 306.24 |
| IUPAC Name | diethyl-methyl-[2-[(2R,3R)-3-methyl-2-phenylpentanoyl]oxyethyl]azanium |
| SMILES | CC[C@@H](C)[C@@H](C(=O)OCC[N+](C)(CC)CC)c1ccccc1 |
| InChI | InChI=1S/C19H32NO2/c1-6-16(4)18(17-12-10-9-11-13-17)19(21)22-15-14-20(5,7-2)8-3/h9-13,16,18H,6-8,14-15H2,1-5H3/q+1/t16-,18-/m1/s1 |
| InChIKey | UPPMZCXMQRVMME-SJLPKXTDSA-N |
| XLogP | 3.85 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.47 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|