C16H21N5O2 — CID 45351361
(4,6-diamino-1,3,5-triazin-2-yl)methyl 3-methyl-2-phenylpentanoate (PubChem CID 45351361) has the molecular formula C16H21N5O2 and a molecular weight of 315.38 g/mol. Its IUPAC name is (4,6-diamino-1,3,5-triazin-2-yl)methyl 3-methyl-2-phenylpentanoate.
| Compound Name | (4,6-diamino-1,3,5-triazin-2-yl)methyl 3-methyl-2-phenylpentanoate |
|---|---|
| PubChem CID | 45351361 |
| Molecular Formula | C16H21N5O2 |
| Molecular Weight | 315.38 g/mol |
| Exact Mass | 315.17 |
| IUPAC Name | (4,6-diamino-1,3,5-triazin-2-yl)methyl 3-methyl-2-phenylpentanoate |
| SMILES | CCC(C)C(C(=O)OCc1nc(N)nc(N)n1)c1ccccc1 |
| InChI | InChI=1S/C16H21N5O2/c1-3-10(2)13(11-7-5-4-6-8-11)14(22)23-9-12-19-15(17)21-16(18)20-12/h4-8,10,13H,3,9H2,1-2H3,(H4,17,18,19,20,21) |
| InChIKey | GPGKJFZQFREGHL-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 117.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.38 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |