C24H33NO3 — CID 10407630
[5-[[methyl(propan-2-yl)amino]methyl]furan-2-yl]methyl 2-cyclohexyl-2-phenylacetate (PubChem CID 10407630) has the molecular formula C24H33NO3 and a molecular weight of 383.53 g/mol. Its IUPAC name is [5-[[methyl(propan-2-yl)amino]methyl]furan-2-yl]methyl 2-cyclohexyl-2-phenylacetate.
| Compound Name | [5-[[methyl(propan-2-yl)amino]methyl]furan-2-yl]methyl 2-cyclohexyl-2-phenylacetate |
|---|---|
| PubChem CID | 10407630 |
| Molecular Formula | C24H33NO3 |
| Molecular Weight | 383.53 g/mol |
| Exact Mass | 383.25 |
| IUPAC Name | [5-[[methyl(propan-2-yl)amino]methyl]furan-2-yl]methyl 2-cyclohexyl-2-phenylacetate |
| SMILES | CC(C)N(C)Cc1ccc(COC(=O)C(c2ccccc2)C2CCCCC2)o1 |
| InChI | InChI=1S/C24H33NO3/c1-18(2)25(3)16-21-14-15-22(28-21)17-27-24(26)23(19-10-6-4-7-11-19)20-12-8-5-9-13-20/h4,6-7,10-11,14-15,18,20,23H,5,8-9,12-13,16-17H2,1-3H3 |
| InChIKey | YXYGRCXVYKPQKN-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.53 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |