C20H19NO6S-2 — CID 2123695
4-[4-[(R)-carboxylato(phenyl)methyl]piperidin-1-yl]sulfonylbenzoate (PubChem CID 2123695) has the molecular formula C20H19NO6S-2 and a molecular weight of 401.44 g/mol. Its IUPAC name is 4-[4-[(R)-carboxylato(phenyl)methyl]piperidin-1-yl]sulfonylbenzoate.
| Compound Name | 4-[4-[(R)-carboxylato(phenyl)methyl]piperidin-1-yl]sulfonylbenzoate |
|---|---|
| PubChem CID | 2123695 |
| Molecular Formula | C20H19NO6S-2 |
| Molecular Weight | 401.44 g/mol |
| Exact Mass | 401.09 |
| IUPAC Name | 4-[4-[(R)-carboxylato(phenyl)methyl]piperidin-1-yl]sulfonylbenzoate |
| SMILES | O=C([O-])c1ccc(S(=O)(=O)N2CCC([C@@H](C(=O)[O-])c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C20H21NO6S/c22-19(23)16-6-8-17(9-7-16)28(26,27)21-12-10-15(11-13-21)18(20(24)25)14-4-2-1-3-5-14/h1-9,15,18H,10-13H2,(H,22,23)(H,24,25)/p-2/t18-/m0/s1 |
| InChIKey | HKOHIFQHESNCCF-SFHVURJKSA-L |
| XLogP | -0.02 |
| TPSA | 117.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.44 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |