C20H21N2O5S- — CID 7059174
(2S)-2-phenyl-2-[(4-piperidin-1-ylsulfonylbenzoyl)amino]acetate (PubChem CID 7059174) has the molecular formula C20H21N2O5S- and a molecular weight of 401.46 g/mol. Its IUPAC name is (2S)-2-phenyl-2-[(4-piperidin-1-ylsulfonylbenzoyl)amino]acetate.
| Compound Name | (2S)-2-phenyl-2-[(4-piperidin-1-ylsulfonylbenzoyl)amino]acetate |
|---|---|
| PubChem CID | 7059174 |
| Molecular Formula | C20H21N2O5S- |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | (2S)-2-phenyl-2-[(4-piperidin-1-ylsulfonylbenzoyl)amino]acetate |
| SMILES | O=C(N[C@H](C(=O)[O-])c1ccccc1)c1ccc(S(=O)(=O)N2CCCCC2)cc1 |
| InChI | InChI=1S/C20H22N2O5S/c23-19(21-18(20(24)25)15-7-3-1-4-8-15)16-9-11-17(12-10-16)28(26,27)22-13-5-2-6-14-22/h1,3-4,7-12,18H,2,5-6,13-14H2,(H,21,23)(H,24,25)/p-1/t18-/m0/s1 |
| InChIKey | BJDSFHNZLPENFW-SFHVURJKSA-M |
| XLogP | 1.08 |
| TPSA | 106.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |