C25H20N3O6S- — CID 2052107
4-[4-[4-(1,3-dioxoisoindol-2-yl)phenyl]sulfonylpiperazin-1-yl]benzoate (PubChem CID 2052107) has the molecular formula C25H20N3O6S- and a molecular weight of 490.52 g/mol. Its IUPAC name is 4-[4-[4-(1,3-dioxoisoindol-2-yl)phenyl]sulfonylpiperazin-1-yl]benzoate.
| Compound Name | 4-[4-[4-(1,3-dioxoisoindol-2-yl)phenyl]sulfonylpiperazin-1-yl]benzoate |
|---|---|
| PubChem CID | 2052107 |
| Molecular Formula | C25H20N3O6S- |
| Molecular Weight | 490.52 g/mol |
| Exact Mass | 490.11 |
| IUPAC Name | 4-[4-[4-(1,3-dioxoisoindol-2-yl)phenyl]sulfonylpiperazin-1-yl]benzoate |
| SMILES | O=C([O-])c1ccc(N2CCN(S(=O)(=O)c3ccc(N4C(=O)c5ccccc5C4=O)cc3)CC2)cc1 |
| InChI | InChI=1S/C25H21N3O6S/c29-23-21-3-1-2-4-22(21)24(30)28(23)19-9-11-20(12-10-19)35(33,34)27-15-13-26(14-16-27)18-7-5-17(6-8-18)25(31)32/h1-12H,13-16H2,(H,31,32)/p-1 |
| InChIKey | VEWFOCYRVVBVQQ-UHFFFAOYSA-M |
| XLogP | 1.36 |
| TPSA | 118.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.52 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|