C20H16N3O7S- — CID 2051909
2-[4-[4-(1,3-dioxoisoindol-2-yl)phenyl]sulfonylpiperazin-1-yl]-2-oxoacetate (PubChem CID 2051909) has the molecular formula C20H16N3O7S- and a molecular weight of 442.43 g/mol. Its IUPAC name is 2-[4-[4-(1,3-dioxoisoindol-2-yl)phenyl]sulfonylpiperazin-1-yl]-2-oxoacetate.
| Compound Name | 2-[4-[4-(1,3-dioxoisoindol-2-yl)phenyl]sulfonylpiperazin-1-yl]-2-oxoacetate |
|---|---|
| PubChem CID | 2051909 |
| Molecular Formula | C20H16N3O7S- |
| Molecular Weight | 442.43 g/mol |
| Exact Mass | 442.07 |
| IUPAC Name | 2-[4-[4-(1,3-dioxoisoindol-2-yl)phenyl]sulfonylpiperazin-1-yl]-2-oxoacetate |
| SMILES | O=C([O-])C(=O)N1CCN(S(=O)(=O)c2ccc(N3C(=O)c4ccccc4C3=O)cc2)CC1 |
| InChI | InChI=1S/C20H17N3O7S/c24-17-15-3-1-2-4-16(15)18(25)23(17)13-5-7-14(8-6-13)31(29,30)22-11-9-21(10-12-22)19(26)20(27)28/h1-8H,9-12H2,(H,27,28)/p-1 |
| InChIKey | NEKNISCDCFMTNQ-UHFFFAOYSA-M |
| XLogP | -0.93 |
| TPSA | 135.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.43 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|