About 6-methylheptyl N-[2,6-di(propan-2-yl)phenoxy]sulfonylcarbamate
6-methylheptyl N-[2,6-di(propan-2-yl)phenoxy]sulfonylcarbamate (PubChem CID 101053505) has the molecular formula C21H35NO5S
and a molecular weight of 413.58 g/mol. Its IUPAC name is 6-methylheptyl N-[2,6-di(propan-2-yl)phenoxy]sulfonylcarbamate.
Molecular Properties
| Compound Name | 6-methylheptyl N-[2,6-di(propan-2-yl)phenoxy]sulfonylcarbamate |
| PubChem CID | 101053505 |
| Molecular Formula | C21H35NO5S |
| Molecular Weight | 413.58 g/mol |
| Exact Mass | 413.22 |
| IUPAC Name | 6-methylheptyl N-[2,6-di(propan-2-yl)phenoxy]sulfonylcarbamate |
| SMILES | CC(C)CCCCCOC(=O)NS(=O)(=O)Oc1c(C(C)C)cccc1C(C)C |
| InChI | InChI=1S/C21H35NO5S/c1-15(2)11-8-7-9-14-26-21(23)22-28(24,25)27-20-18(16(3)4)12-10-13-19(20)17(5)6/h10,12-13,15-17H,7-9,11,14H2,1-6H3,(H,22,23) |
| InChIKey | UGJAKCNAUXACCF-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 413.58 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-methylheptyl N-[2,6-di(propan-2-yl)phenoxy]sulfonylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methylheptyl N-[2,6-di(propan-2-yl)phenoxy]sulfonylcarbamate?
The IUPAC name of 6-methylheptyl N-[2,6-di(propan-2-yl)phenoxy]sulfonylcarbamate (CID 101053505) is 6-methylheptyl N-[2,6-di(propan-2-yl)phenoxy]sulfonylcarbamate.
What is the SMILES notation for 6-methylheptyl N-[2,6-di(propan-2-yl)phenoxy]sulfonylcarbamate?
The canonical SMILES for 6-methylheptyl N-[2,6-di(propan-2-yl)phenoxy]sulfonylcarbamate is CC(C)CCCCCOC(=O)NS(=O)(=O)Oc1c(C(C)C)cccc1C(C)C.
What is the InChIKey of 6-methylheptyl N-[2,6-di(propan-2-yl)phenoxy]sulfonylcarbamate?
The InChIKey is UGJAKCNAUXACCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H35NO5S/c1-15(2)11-8-7-9-14-26-21(23)22-28(24,25)27-20-18(16(3)4)12-10-13-19(20)17(5)6/h10,12-13,15-17H,7-9,11,14H2,1-6H3,(H,22,23).
What are the key properties of 6-methylheptyl N-[2,6-di(propan-2-yl)phenoxy]sulfonylcarbamate?
6-methylheptyl N-[2,6-di(propan-2-yl)phenoxy]sulfonylcarbamate has a molecular weight of 413.58 g/mol, XLogP of 5.50, 11 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methylheptyl N-[2,6-di(propan-2-yl)phenoxy]sulfonylcarbamate is sourced from PubChem (CID 101053505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).