About 8-methylnonyl N-aminocarbamate
8-methylnonyl N-aminocarbamate (PubChem CID 151869472) has the molecular formula C11H24N2O2
and a molecular weight of 216.32 g/mol. Its IUPAC name is 8-methylnonyl N-aminocarbamate.
Molecular Properties
| Compound Name | 8-methylnonyl N-aminocarbamate |
| PubChem CID | 151869472 |
| Molecular Formula | C11H24N2O2 |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.18 |
| IUPAC Name | 8-methylnonyl N-aminocarbamate |
| SMILES | CC(C)CCCCCCCOC(=O)NN |
| InChI | InChI=1S/C11H24N2O2/c1-10(2)8-6-4-3-5-7-9-15-11(14)13-12/h10H,3-9,12H2,1-2H3,(H,13,14) |
| InChIKey | SMJOKOWDIPSCEZ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 8-methylnonyl N-aminocarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methylnonyl N-aminocarbamate?
The IUPAC name of 8-methylnonyl N-aminocarbamate (CID 151869472) is 8-methylnonyl N-aminocarbamate.
What is the SMILES notation for 8-methylnonyl N-aminocarbamate?
The canonical SMILES for 8-methylnonyl N-aminocarbamate is CC(C)CCCCCCCOC(=O)NN.
What is the InChIKey of 8-methylnonyl N-aminocarbamate?
The InChIKey is SMJOKOWDIPSCEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H24N2O2/c1-10(2)8-6-4-3-5-7-9-15-11(14)13-12/h10H,3-9,12H2,1-2H3,(H,13,14).
What are the key properties of 8-methylnonyl N-aminocarbamate?
8-methylnonyl N-aminocarbamate has a molecular weight of 216.32 g/mol, XLogP of 2.58, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methylnonyl N-aminocarbamate is sourced from PubChem (CID 151869472), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).