About nickel(2+);bis(3-propan-2-yl-2-propan-2-yloxybenzoate)
nickel(2+);bis(3-propan-2-yl-2-propan-2-yloxybenzoate) (PubChem CID 19810778) has the molecular formula C26H34NiO6
and a molecular weight of 501.25 g/mol. Its IUPAC name is nickel(2+);bis(3-propan-2-yl-2-propan-2-yloxybenzoate).
Molecular Properties
| Compound Name | nickel(2+);bis(3-propan-2-yl-2-propan-2-yloxybenzoate) |
| PubChem CID | 19810778 |
| Molecular Formula | C26H34NiO6 |
| Molecular Weight | 501.25 g/mol |
| Exact Mass | 500.17 |
| IUPAC Name | nickel(2+);bis(3-propan-2-yl-2-propan-2-yloxybenzoate) |
| SMILES | CC(C)Oc1c(C(=O)[O-])cccc1C(C)C.CC(C)Oc1c(C(=O)[O-])cccc1C(C)C.[Ni+2] |
| InChI | InChI=1S/2C13H18O3.Ni/c2*1-8(2)10-6-5-7-11(13(14)15)12(10)16-9(3)4;/h2*5-9H,1-4H3,(H,14,15);/q;;+2/p-2 |
| InChIKey | RCFDPHRRWHOZLJ-UHFFFAOYSA-L |
| XLogP | 3.92 |
| TPSA | 98.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 501.25 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze nickel(2+);bis(3-propan-2-yl-2-propan-2-yloxybenzoate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nickel(2+);bis(3-propan-2-yl-2-propan-2-yloxybenzoate)?
The IUPAC name of nickel(2+);bis(3-propan-2-yl-2-propan-2-yloxybenzoate) (CID 19810778) is nickel(2+);bis(3-propan-2-yl-2-propan-2-yloxybenzoate).
What is the SMILES notation for nickel(2+);bis(3-propan-2-yl-2-propan-2-yloxybenzoate)?
The canonical SMILES for nickel(2+);bis(3-propan-2-yl-2-propan-2-yloxybenzoate) is CC(C)Oc1c(C(=O)[O-])cccc1C(C)C.CC(C)Oc1c(C(=O)[O-])cccc1C(C)C.[Ni+2].
What is the InChIKey of nickel(2+);bis(3-propan-2-yl-2-propan-2-yloxybenzoate)?
The InChIKey is RCFDPHRRWHOZLJ-UHFFFAOYSA-L. The full InChI is InChI=1S/2C13H18O3.Ni/c2*1-8(2)10-6-5-7-11(13(14)15)12(10)16-9(3)4;/h2*5-9H,1-4H3,(H,14,15);/q;;+2/p-2.
What are the key properties of nickel(2+);bis(3-propan-2-yl-2-propan-2-yloxybenzoate)?
nickel(2+);bis(3-propan-2-yl-2-propan-2-yloxybenzoate) has a molecular weight of 501.25 g/mol, XLogP of 3.92, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for nickel(2+);bis(3-propan-2-yl-2-propan-2-yloxybenzoate) is sourced from PubChem (CID 19810778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).