C20H30O2 — CID 59708783
[2,4-ditert-butyl-6-(2-methylprop-1-enyl)phenyl] acetate (PubChem CID 59708783) has the molecular formula C20H30O2 and a molecular weight of 302.46 g/mol. Its IUPAC name is [2,4-ditert-butyl-6-(2-methylprop-1-enyl)phenyl] acetate.
| Compound Name | [2,4-ditert-butyl-6-(2-methylprop-1-enyl)phenyl] acetate |
|---|---|
| PubChem CID | 59708783 |
| Molecular Formula | C20H30O2 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | [2,4-ditert-butyl-6-(2-methylprop-1-enyl)phenyl] acetate |
| SMILES | CC(=O)Oc1c(C=C(C)C)cc(C(C)(C)C)cc1C(C)(C)C |
| InChI | InChI=1S/C20H30O2/c1-13(2)10-15-11-16(19(4,5)6)12-17(20(7,8)9)18(15)22-14(3)21/h10-12H,1-9H3 |
| InChIKey | IIEBIHZDSADXIT-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|