C19H28O3 — CID 170873208
(E)-3-(3,5-ditert-butyl-2-methoxyphenyl)-2-methylprop-2-enoic acid (PubChem CID 170873208) has the molecular formula C19H28O3 and a molecular weight of 304.43 g/mol. Its IUPAC name is (E)-3-(3,5-ditert-butyl-2-methoxyphenyl)-2-methylprop-2-enoic acid.
| Compound Name | (E)-3-(3,5-ditert-butyl-2-methoxyphenyl)-2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 170873208 |
| Molecular Formula | C19H28O3 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | (E)-3-(3,5-ditert-butyl-2-methoxyphenyl)-2-methylprop-2-enoic acid |
| SMILES | COc1c(/C=C(\C)C(=O)O)cc(C(C)(C)C)cc1C(C)(C)C |
| InChI | InChI=1S/C19H28O3/c1-12(17(20)21)9-13-10-14(18(2,3)4)11-15(16(13)22-8)19(5,6)7/h9-11H,1-8H3,(H,20,21)/b12-9+ |
| InChIKey | XTUNKFVXNAGTDU-FMIVXFBMSA-N |
| XLogP | 4.78 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|