About 5-[3-(3,5-ditert-butyl-2-methoxyphenyl)phenyl]-3-methylpenta-2,4-dienoic acid
5-[3-(3,5-ditert-butyl-2-methoxyphenyl)phenyl]-3-methylpenta-2,4-dienoic acid (PubChem CID 90706399) has the molecular formula C27H34O3
and a molecular weight of 406.57 g/mol. Its IUPAC name is 5-[3-(3,5-ditert-butyl-2-methoxyphenyl)phenyl]-3-methylpenta-2,4-dienoic acid.
Molecular Properties
| Compound Name | 5-[3-(3,5-ditert-butyl-2-methoxyphenyl)phenyl]-3-methylpenta-2,4-dienoic acid |
| PubChem CID | 90706399 |
| Molecular Formula | C27H34O3 |
| Molecular Weight | 406.57 g/mol |
| Exact Mass | 406.25 |
| IUPAC Name | 5-[3-(3,5-ditert-butyl-2-methoxyphenyl)phenyl]-3-methylpenta-2,4-dienoic acid |
| SMILES | COc1c(-c2cccc(C=CC(C)=CC(=O)O)c2)cc(C(C)(C)C)cc1C(C)(C)C |
| InChI | InChI=1S/C27H34O3/c1-18(14-24(28)29)12-13-19-10-9-11-20(15-19)22-16-21(26(2,3)4)17-23(25(22)30-8)27(5,6)7/h9-17H,1-8H3,(H,28,29) |
| InChIKey | ZLCJZYJGBPOWCQ-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 406.57 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 5-[3-(3,5-ditert-butyl-2-methoxyphenyl)phenyl]-3-methylpenta-2,4-dienoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[3-(3,5-ditert-butyl-2-methoxyphenyl)phenyl]-3-methylpenta-2,4-dienoic acid?
The IUPAC name of 5-[3-(3,5-ditert-butyl-2-methoxyphenyl)phenyl]-3-methylpenta-2,4-dienoic acid (CID 90706399) is 5-[3-(3,5-ditert-butyl-2-methoxyphenyl)phenyl]-3-methylpenta-2,4-dienoic acid.
What is the SMILES notation for 5-[3-(3,5-ditert-butyl-2-methoxyphenyl)phenyl]-3-methylpenta-2,4-dienoic acid?
The canonical SMILES for 5-[3-(3,5-ditert-butyl-2-methoxyphenyl)phenyl]-3-methylpenta-2,4-dienoic acid is COc1c(-c2cccc(C=CC(C)=CC(=O)O)c2)cc(C(C)(C)C)cc1C(C)(C)C.
What is the InChIKey of 5-[3-(3,5-ditert-butyl-2-methoxyphenyl)phenyl]-3-methylpenta-2,4-dienoic acid?
The InChIKey is ZLCJZYJGBPOWCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H34O3/c1-18(14-24(28)29)12-13-19-10-9-11-20(15-19)22-16-21(26(2,3)4)17-23(25(22)30-8)27(5,6)7/h9-17H,1-8H3,(H,28,29).
What are the key properties of 5-[3-(3,5-ditert-butyl-2-methoxyphenyl)phenyl]-3-methylpenta-2,4-dienoic acid?
5-[3-(3,5-ditert-butyl-2-methoxyphenyl)phenyl]-3-methylpenta-2,4-dienoic acid has a molecular weight of 406.57 g/mol, XLogP of 7.00, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[3-(3,5-ditert-butyl-2-methoxyphenyl)phenyl]-3-methylpenta-2,4-dienoic acid is sourced from PubChem (CID 90706399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).